C23H22F2N6O3 — CID 123223901
5-fluoro-N-[(3-fluoro-4-methoxyphenyl)-(1H-pyrazol-4-yl)methyl]-2-(2-methoxyethylamino)quinazoline-7-carboxamide (PubChem CID 123223901) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)-(1H-pyrazol-4-yl)methyl]-2-(2-methoxyethylamino)quinazoline-7-carboxamide.
| Compound Name | 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)-(1H-pyrazol-4-yl)methyl]-2-(2-methoxyethylamino)quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 123223901 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)-(1H-pyrazol-4-yl)methyl]-2-(2-methoxyethylamino)quinazoline-7-carboxamide |
| SMILES | COCCNc1ncc2c(F)cc(C(=O)NC(c3cn[nH]c3)c3ccc(OC)c(F)c3)cc2n1 |
| InChI | InChI=1S/C23H22F2N6O3/c1-33-6-5-26-23-27-12-16-17(24)8-14(9-19(16)30-23)22(32)31-21(15-10-28-29-11-15)13-3-4-20(34-2)18(25)7-13/h3-4,7-12,21H,5-6H2,1-2H3,(H,28,29)(H,31,32)(H,26,27,30) |
| InChIKey | JTCCXRVYOLPFGT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|