C21H13FN3O+ — CID 123224069
3-(4-fluorophenyl)-5-(1-pyridin-2-ylazet-1-ium-2-yl)-2,1-benzoxazole (PubChem CID 123224069) has the molecular formula C21H13FN3O+ and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(1-pyridin-2-ylazet-1-ium-2-yl)-2,1-benzoxazole.
| Compound Name | 3-(4-fluorophenyl)-5-(1-pyridin-2-ylazet-1-ium-2-yl)-2,1-benzoxazole |
|---|---|
| PubChem CID | 123224069 |
| Molecular Formula | C21H13FN3O+ |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(1-pyridin-2-ylazet-1-ium-2-yl)-2,1-benzoxazole |
| SMILES | Fc1ccc(-c2onc3ccc(C4=[N+](c5ccccn5)C=C4)cc23)cc1 |
| InChI | InChI=1S/C21H13FN3O/c22-16-7-4-14(5-8-16)21-17-13-15(6-9-18(17)24-26-21)19-10-12-25(19)20-3-1-2-11-23-20/h1-13H/q+1 |
| InChIKey | NGSBOPYJBIVCGA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|