C22H14F3N3O — CID 45484856
7-(1H-indol-5-yl)-N-[4-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 45484856) has the molecular formula C22H14F3N3O and a molecular weight of 393.37 g/mol. Its IUPAC name is 7-(1H-indol-5-yl)-N-[4-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-(1H-indol-5-yl)-N-[4-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 45484856 |
| Molecular Formula | C22H14F3N3O |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 7-(1H-indol-5-yl)-N-[4-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | FC(F)(F)c1ccc(Nc2noc3c(-c4ccc5[nH]ccc5c4)cccc23)cc1 |
| InChI | InChI=1S/C22H14F3N3O/c23-22(24,25)15-5-7-16(8-6-15)27-21-18-3-1-2-17(20(18)29-28-21)13-4-9-19-14(12-13)10-11-26-19/h1-12,26H,(H,27,28) |
| InChIKey | LQDVKGMXBYIUOZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |