C15H10F3IN2O — CID 146484443
7-iodo-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 146484443) has the molecular formula C15H10F3IN2O and a molecular weight of 418.16 g/mol. Its IUPAC name is 7-iodo-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-iodo-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146484443 |
| Molecular Formula | C15H10F3IN2O |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 7-iodo-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(Nc3cccc(C(F)(F)F)c3)noc2c1I |
| InChI | InChI=1S/C15H10F3IN2O/c1-8-5-6-11-13(12(8)19)22-21-14(11)20-10-4-2-3-9(7-10)15(16,17)18/h2-7H,1H3,(H,20,21) |
| InChIKey | ZNLWJENDJLEGFI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|