C30H31F2N3O — CID 156643837
N-[3-(1,1-difluoroethyl)phenyl]-7-[2-[5-[(1Z,3E)-hexa-1,3-dienyl]-1,4-dimethylpyrrol-2-yl]ethynyl]-6-methyl-1,2-benzoxazol-3-amine;molecular hydrogen (PubChem CID 156643837) has the molecular formula C30H31F2N3O and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-7-[2-[5-[(1Z,3E)-hexa-1,3-dienyl]-1,4-dimethylpyrrol-2-yl]ethynyl]-6-methyl-1,2-benzoxazol-3-amine;molecular hydrogen.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-7-[2-[5-[(1Z,3E)-hexa-1,3-dienyl]-1,4-dimethylpyrrol-2-yl]ethynyl]-6-methyl-1,2-benzoxazol-3-amine;molecular hydrogen |
|---|---|
| PubChem CID | 156643837 |
| Molecular Formula | C30H31F2N3O |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-7-[2-[5-[(1Z,3E)-hexa-1,3-dienyl]-1,4-dimethylpyrrol-2-yl]ethynyl]-6-methyl-1,2-benzoxazol-3-amine;molecular hydrogen |
| SMILES | CC/C=C/C=C\c1c(C)cc(C#Cc2c(C)ccc3c(Nc4cccc(C(C)(F)F)c4)noc23)n1C.[H][H] |
| InChI | InChI=1S/C30H29F2N3O.H2/c1-6-7-8-9-13-27-21(3)18-24(35(27)5)15-17-25-20(2)14-16-26-28(25)36-34-29(26)33-23-12-10-11-22(19-23)30(4,31)32;/h7-14,16,18-19H,6H2,1-5H3,(H,33,34);1H/b8-7+,13-9-; |
| InChIKey | DNNLVCNTBXOTAR-NIHWTHLUSA-N |
| XLogP | 8.26 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|