C23H14F3N5O2 — CID 146522930
7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 146522930) has the molecular formula C23H14F3N5O2 and a molecular weight of 449.39 g/mol. Its IUPAC name is 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146522930 |
| Molecular Formula | C23H14F3N5O2 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(Nc3cccc(OC(F)(F)F)c3)noc2c1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C23H14F3N5O2/c1-14-7-9-19-21(18(14)10-8-16-13-27-20-6-3-11-28-31(16)20)33-30-22(19)29-15-4-2-5-17(12-15)32-23(24,25)26/h2-7,9,11-13H,1H3,(H,29,30) |
| InChIKey | VUIGEDUPCXHWEP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|