C16H11F5N2O2 — CID 89459643
7-fluoro-N-[3-(1,1,2,2-tetrafluoropropoxy)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 89459643) has the molecular formula C16H11F5N2O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 7-fluoro-N-[3-(1,1,2,2-tetrafluoropropoxy)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-fluoro-N-[3-(1,1,2,2-tetrafluoropropoxy)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 89459643 |
| Molecular Formula | C16H11F5N2O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 7-fluoro-N-[3-(1,1,2,2-tetrafluoropropoxy)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | CC(F)(F)C(F)(F)Oc1cccc(Nc2noc3c(F)cccc23)c1 |
| InChI | InChI=1S/C16H11F5N2O2/c1-15(18,19)16(20,21)24-10-5-2-4-9(8-10)22-14-11-6-3-7-12(17)13(11)25-23-14/h2-8H,1H3,(H,22,23) |
| InChIKey | HYUHBKNCZYHOIJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|