C19H17F3IN3O — CID 146484447
N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-7-iodo-6-methyl-1,2-benzoxazol-3-amine (PubChem CID 146484447) has the molecular formula C19H17F3IN3O and a molecular weight of 487.26 g/mol. Its IUPAC name is N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-7-iodo-6-methyl-1,2-benzoxazol-3-amine.
| Compound Name | N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-7-iodo-6-methyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146484447 |
| Molecular Formula | C19H17F3IN3O |
| Molecular Weight | 487.26 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-7-iodo-6-methyl-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(Nc3cc(CNC4CC4)cc(C(F)(F)F)c3)noc2c1I |
| InChI | InChI=1S/C19H17F3IN3O/c1-10-2-5-15-17(16(10)23)27-26-18(15)25-14-7-11(9-24-13-3-4-13)6-12(8-14)19(20,21)22/h2,5-8,13,24H,3-4,9H2,1H3,(H,25,26) |
| InChIKey | IIYUWJLFCNHVSM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.26 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|