C27H29F3N6O2 — CID 71034847
3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-4-methylbenzamide (PubChem CID 71034847) has the molecular formula C27H29F3N6O2 and a molecular weight of 526.56 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 71034847 |
| Molecular Formula | C27H29F3N6O2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
| SMILES | COc1cncc(/C(N)=C/N(N)c2cc(C(=O)Nc3cc(CNC4CC4)cc(C(F)(F)F)c3)ccc2C)c1 |
| InChI | InChI=1S/C27H29F3N6O2/c1-16-3-4-18(10-25(16)36(32)15-24(31)19-9-23(38-2)14-33-13-19)26(37)35-22-8-17(12-34-21-5-6-21)7-20(11-22)27(28,29)30/h3-4,7-11,13-15,21,34H,5-6,12,31-32H2,1-2H3,(H,35,37)/b24-15- |
| InChIKey | LOEFXCUTGFBZKF-IWIPYMOSSA-N |
| XLogP | 4.56 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|