C24H24ClF3N6O3 — CID 71035121
3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-(aminomethyl)-2-methoxy-5-(trifluoromethyl)phenyl]-4-chlorobenzamide (PubChem CID 71035121) has the molecular formula C24H24ClF3N6O3 and a molecular weight of 536.94 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-(aminomethyl)-2-methoxy-5-(trifluoromethyl)phenyl]-4-chlorobenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-(aminomethyl)-2-methoxy-5-(trifluoromethyl)phenyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 71035121 |
| Molecular Formula | C24H24ClF3N6O3 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-(aminomethyl)-2-methoxy-5-(trifluoromethyl)phenyl]-4-chlorobenzamide |
| SMILES | COc1cncc(/C(N)=C/N(N)c2cc(C(=O)Nc3cc(C(F)(F)F)cc(CN)c3OC)ccc2Cl)c1 |
| InChI | InChI=1S/C24H24ClF3N6O3/c1-36-17-6-15(10-32-11-17)19(30)12-34(31)21-7-13(3-4-18(21)25)23(35)33-20-8-16(24(26,27)28)5-14(9-29)22(20)37-2/h3-8,10-12H,9,29-31H2,1-2H3,(H,33,35)/b19-12- |
| InChIKey | BWJHASOYGKPQNP-UNOMPAQXSA-N |
| XLogP | 4.12 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|