C21H25F3N5O6S+ — CID 163795332
[1-[N-amino-5-[[3-(methanesulfonamido)-2-methoxy-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylanilino]-3-methoxy-3-oxoprop-1-en-2-yl]azanium (PubChem CID 163795332) has the molecular formula C21H25F3N5O6S+ and a molecular weight of 532.52 g/mol. Its IUPAC name is [1-[N-amino-5-[[3-(methanesulfonamido)-2-methoxy-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylanilino]-3-methoxy-3-oxoprop-1-en-2-yl]azanium.
| Compound Name | [1-[N-amino-5-[[3-(methanesulfonamido)-2-methoxy-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylanilino]-3-methoxy-3-oxoprop-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 163795332 |
| Molecular Formula | C21H25F3N5O6S+ |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | [1-[N-amino-5-[[3-(methanesulfonamido)-2-methoxy-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylanilino]-3-methoxy-3-oxoprop-1-en-2-yl]azanium |
| SMILES | COC(=O)C([NH3+])=CN(N)c1cc(C(=O)Nc2cc(C(F)(F)F)cc(NS(C)(=O)=O)c2OC)ccc1C |
| InChI | InChI=1S/C21H24F3N5O6S/c1-11-5-6-12(7-17(11)29(26)10-14(25)20(31)35-3)19(30)27-15-8-13(21(22,23)24)9-16(18(15)34-2)28-36(4,32)33/h5-10,28H,25-26H2,1-4H3,(H,27,30)/p+1 |
| InChIKey | NAGRCKHZLPVTSB-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 167.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|