C29H40N7O4S+ — CID 143110859
3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide (PubChem CID 143110859) has the molecular formula C29H40N7O4S+ and a molecular weight of 582.75 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110859 |
| Molecular Formula | C29H40N7O4S+ |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(N(N)/C=C(\N)c3c[n+](C)c(C4CC4)[nH]3)c2)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H39N7O4S/c1-17-8-9-19(12-25(17)36(31)15-21(30)24-16-35(5)27(32-24)18-10-11-18)28(37)33-22-13-20(29(2,3)4)14-23(26(22)40-6)34-41(7,38)39/h8-9,12-16,18,34H,10-11,30-31H2,1-7H3,(H,33,37)/p+1/b21-15- |
| InChIKey | SGAKUIZJGPZEQV-QNGOZBTKSA-O |
| XLogP | 3.59 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|