C29H43N7O2S — CID 143110718
3-[amino-[(1Z,3E)-2-amino-4-[amino(cyclopropyl)amino]-3-methylpenta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide (PubChem CID 143110718) has the molecular formula C29H43N7O2S and a molecular weight of 553.78 g/mol. Its IUPAC name is 3-[amino-[(1Z,3E)-2-amino-4-[amino(cyclopropyl)amino]-3-methylpenta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(1Z,3E)-2-amino-4-[amino(cyclopropyl)amino]-3-methylpenta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110718 |
| Molecular Formula | C29H43N7O2S |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 3-[amino-[(1Z,3E)-2-amino-4-[amino(cyclopropyl)amino]-3-methylpenta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)/C=C(N)/C(C)=C(\C)N(N)C2CC2)c1 |
| InChI | InChI=1S/C29H43N7O2S/c1-17-9-10-20(13-26(17)35(31)16-23(30)18(2)19(3)36(32)22-11-12-22)28(37)33-24-14-21(29(4,5)6)15-25(34-39-8)27(24)38-7/h9-10,13-16,22,34H,11-12,30-32H2,1-8H3,(H,33,37)/b19-18+,23-16- |
| InChIKey | BXAFLHODYYZPDO-MLNMHTJZSA-N |
| XLogP | 5.36 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|