C32H44N6O3S — CID 142903865
3-[amino-[(Z)-2-amino-3-(methylamino)-3-oxoprop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide;1-methylcyclohepta-1,3,5-triene (PubChem CID 142903865) has the molecular formula C32H44N6O3S and a molecular weight of 592.81 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-3-(methylamino)-3-oxoprop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide;1-methylcyclohepta-1,3,5-triene.
| Compound Name | 3-[amino-[(Z)-2-amino-3-(methylamino)-3-oxoprop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide;1-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142903865 |
| Molecular Formula | C32H44N6O3S |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-3-(methylamino)-3-oxoprop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide;1-methylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC=CC=CC1.CNC(=O)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(C(C)(C)C)cc(NSC)c2OC)ccc1C |
| InChI | InChI=1S/C24H34N6O3S.C8H10/c1-14-8-9-15(10-20(14)30(26)13-17(25)23(32)27-5)22(31)28-18-11-16(24(2,3)4)12-19(29-34-7)21(18)33-6;1-8-6-4-2-3-5-7-8/h8-13,29H,25-26H2,1-7H3,(H,27,32)(H,28,31);2-6H,7H2,1H3/b17-13-; |
| InChIKey | FWLDUTDIULMEEJ-VSORCOHTSA-N |
| XLogP | 5.92 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|