C27H40N6O3 — CID 146846707
3-[amino-[2-amino-3-(2,2-dimethylpropylamino)-3-oxoprop-1-enyl]amino]-N-(3-amino-5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide (PubChem CID 146846707) has the molecular formula C27H40N6O3 and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-[amino-[2-amino-3-(2,2-dimethylpropylamino)-3-oxoprop-1-enyl]amino]-N-(3-amino-5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide.
| Compound Name | 3-[amino-[2-amino-3-(2,2-dimethylpropylamino)-3-oxoprop-1-enyl]amino]-N-(3-amino-5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 146846707 |
| Molecular Formula | C27H40N6O3 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 3-[amino-[2-amino-3-(2,2-dimethylpropylamino)-3-oxoprop-1-enyl]amino]-N-(3-amino-5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide |
| SMILES | COc1c(N)cc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)C=C(N)C(=O)NCC(C)(C)C)c1 |
| InChI | InChI=1S/C27H40N6O3/c1-16-9-10-17(11-22(16)33(30)14-20(29)25(35)31-15-26(2,3)4)24(34)32-21-13-18(27(5,6)7)12-19(28)23(21)36-8/h9-14H,15,28-30H2,1-8H3,(H,31,35)(H,32,34) |
| InChIKey | SHIBEKKFQGIBEZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 148.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|