C31H40N6O3S — CID 142903953
3-[amino-[(Z)-2-amino-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide (PubChem CID 142903953) has the molecular formula C31H40N6O3S and a molecular weight of 576.77 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 142903953 |
| Molecular Formula | C31H40N6O3S |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)/C=C(\N)C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C31H40N6O3S/c1-19-13-14-22(29(38)35-25-16-23(31(3,4)5)17-26(36-41-7)28(25)40-6)15-27(19)37(33)18-24(32)30(39)34-20(2)21-11-9-8-10-12-21/h8-18,20,36H,32-33H2,1-7H3,(H,34,39)(H,35,38)/b24-18- |
| InChIKey | DGRVELHZPQZLJB-MOHJPFBDSA-N |
| XLogP | 5.60 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|