C27H34N6O4S — CID 163460928
3-[amino-(2-amino-2-pyridin-2-ylethenyl)amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide (PubChem CID 163460928) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 3-[amino-(2-amino-2-pyridin-2-ylethenyl)amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-(2-amino-2-pyridin-2-ylethenyl)amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 163460928 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 3-[amino-(2-amino-2-pyridin-2-ylethenyl)amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(N(N)C=C(N)c3ccccn3)c2)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C27H34N6O4S/c1-17-10-11-18(13-24(17)33(29)16-20(28)21-9-7-8-12-30-21)26(34)31-22-14-19(27(2,3)4)15-23(25(22)37-5)32-38(6,35)36/h7-16,32H,28-29H2,1-6H3,(H,31,34) |
| InChIKey | BOLZETGICKKYOE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|