C25H33N6O4S2+ — CID 143110619
3-[amino-[(Z)-2-amino-2-(1,3-thiazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide (PubChem CID 143110619) has the molecular formula C25H33N6O4S2+ and a molecular weight of 545.71 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(1,3-thiazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(1,3-thiazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110619 |
| Molecular Formula | C25H33N6O4S2+ |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(1,3-thiazol-3-ium-5-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(N(N)/C=C(\N)c3c[nH+]cs3)c2)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C25H32N6O4S2/c1-15-7-8-16(9-21(15)31(27)13-18(26)22-12-28-14-36-22)24(32)29-19-10-17(25(2,3)4)11-20(23(19)35-5)30-37(6,33)34/h7-14,30H,26-27H2,1-6H3,(H,29,32)/p+1/b18-13- |
| InChIKey | NWIJMAQFYQYXNI-AQTBWJFISA-O |
| XLogP | 3.44 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|