C27H33ClN6O2S — CID 143110866
3-[amino-[(Z)-2-amino-2-(6-chloro-3-pyridinyl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide (PubChem CID 143110866) has the molecular formula C27H33ClN6O2S and a molecular weight of 541.12 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(6-chloro-3-pyridinyl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(6-chloro-3-pyridinyl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110866 |
| Molecular Formula | C27H33ClN6O2S |
| Molecular Weight | 541.12 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(6-chloro-3-pyridinyl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)/C=C(\N)c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C27H33ClN6O2S/c1-16-7-8-17(11-23(16)34(30)15-20(29)18-9-10-24(28)31-14-18)26(35)32-21-12-19(27(2,3)4)13-22(33-37-6)25(21)36-5/h7-15,33H,29-30H2,1-6H3,(H,32,35)/b20-15- |
| InChIKey | AUBRDUMVRKIAMH-HKWRFOASSA-N |
| XLogP | 5.93 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.12 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|