C31H43N7O2S — CID 143110739
3-[amino-[(Z)-2-amino-2-(3-cyclopropyl-2-propan-2-ylimidazol-4-yl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide (PubChem CID 143110739) has the molecular formula C31H43N7O2S and a molecular weight of 577.80 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(3-cyclopropyl-2-propan-2-ylimidazol-4-yl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(3-cyclopropyl-2-propan-2-ylimidazol-4-yl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110739 |
| Molecular Formula | C31H43N7O2S |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(3-cyclopropyl-2-propan-2-ylimidazol-4-yl)ethenyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)/C=C(\N)c2cnc(C(C)C)n2C2CC2)c1 |
| InChI | InChI=1S/C31H43N7O2S/c1-18(2)29-34-16-27(38(29)22-11-12-22)23(32)17-37(33)26-13-20(10-9-19(26)3)30(39)35-24-14-21(31(4,5)6)15-25(36-41-8)28(24)40-7/h9-10,13-18,22,36H,11-12,32-33H2,1-8H3,(H,35,39)/b23-17- |
| InChIKey | IQBLSUWOFKAODE-QJOMJCCJSA-N |
| XLogP | 6.54 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|