C28H42N8O2S — CID 143110708
3-[amino-[(1Z)-2-amino-3-[(N,N,N'-trimethylcarbamimidoyl)amino]buta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide (PubChem CID 143110708) has the molecular formula C28H42N8O2S and a molecular weight of 554.77 g/mol. Its IUPAC name is 3-[amino-[(1Z)-2-amino-3-[(N,N,N'-trimethylcarbamimidoyl)amino]buta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(1Z)-2-amino-3-[(N,N,N'-trimethylcarbamimidoyl)amino]buta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110708 |
| Molecular Formula | C28H42N8O2S |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | 3-[amino-[(1Z)-2-amino-3-[(N,N,N'-trimethylcarbamimidoyl)amino]buta-1,3-dienyl]amino]-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-methylbenzamide |
| SMILES | C=C(N/C(=N/C)N(C)C)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(C(C)(C)C)cc(NSC)c2OC)ccc1C |
| InChI | InChI=1S/C28H42N8O2S/c1-17-11-12-19(13-24(17)36(30)16-21(29)18(2)32-27(31-6)35(7)8)26(37)33-22-14-20(28(3,4)5)15-23(34-39-10)25(22)38-9/h11-16,34H,2,29-30H2,1,3-10H3,(H,31,32)(H,33,37)/b21-16- |
| InChIKey | KUMDDYSZLYSJDQ-PGMHBOJBSA-N |
| XLogP | 4.37 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|