C25H35N5O4S — CID 142903850
methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]carbamoyl]-2,3-dimethylanilino]prop-2-enoate (PubChem CID 142903850) has the molecular formula C25H35N5O4S and a molecular weight of 501.65 g/mol. Its IUPAC name is methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]carbamoyl]-2,3-dimethylanilino]prop-2-enoate.
| Compound Name | methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]carbamoyl]-2,3-dimethylanilino]prop-2-enoate |
|---|---|
| PubChem CID | 142903850 |
| Molecular Formula | C25H35N5O4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]carbamoyl]-2,3-dimethylanilino]prop-2-enoate |
| SMILES | COC(=O)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(C(C)(C)C)cc(NSC)c2OC)cc(C)c1C |
| InChI | InChI=1S/C25H35N5O4S/c1-14-9-16(10-21(15(14)2)30(27)13-18(26)24(32)34-7)23(31)28-19-11-17(25(3,4)5)12-20(29-35-8)22(19)33-6/h9-13,29H,26-27H2,1-8H3,(H,28,31)/b18-13- |
| InChIKey | QQORHJJDECKGCP-AQTBWJFISA-N |
| XLogP | 4.20 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|