C25H34FN5O6S — CID 142903911
ethyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-3-fluoro-2-methylanilino]prop-2-enoate (PubChem CID 142903911) has the molecular formula C25H34FN5O6S and a molecular weight of 551.64 g/mol. Its IUPAC name is ethyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-3-fluoro-2-methylanilino]prop-2-enoate.
| Compound Name | ethyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-3-fluoro-2-methylanilino]prop-2-enoate |
|---|---|
| PubChem CID | 142903911 |
| Molecular Formula | C25H34FN5O6S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | ethyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-3-fluoro-2-methylanilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(C(C)(C)C)cc(NS(C)(=O)=O)c2OC)cc(F)c1C |
| InChI | InChI=1S/C25H34FN5O6S/c1-8-37-24(33)18(27)13-31(28)21-10-15(9-17(26)14(21)2)23(32)29-19-11-16(25(3,4)5)12-20(22(19)36-6)30-38(7,34)35/h9-13,30H,8,27-28H2,1-7H3,(H,29,32)/b18-13- |
| InChIKey | JKUWCSWSZAFELF-AQTBWJFISA-N |
| XLogP | 3.11 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|