C27H38N7O5S2+ — CID 143110641
3-[amino-[(Z)-2-amino-2-(3-methyl-2-methylsulfinyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide (PubChem CID 143110641) has the molecular formula C27H38N7O5S2+ and a molecular weight of 604.78 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(3-methyl-2-methylsulfinyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(3-methyl-2-methylsulfinyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143110641 |
| Molecular Formula | C27H38N7O5S2+ |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(3-methyl-2-methylsulfinyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-4-methylbenzamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(N(N)/C=C(\N)c3c[nH]c(S(C)=O)[n+]3C)c2)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C27H37N7O5S2/c1-16-9-10-17(11-22(16)34(29)15-19(28)23-14-30-26(33(23)5)40(7)36)25(35)31-20-12-18(27(2,3)4)13-21(24(20)39-6)32-41(8,37)38/h9-15,32H,28-29H2,1-8H3,(H,31,35)/p+1/b19-15- |
| InChIKey | SHTOQDSURAEHQJ-CYVLTUHYSA-O |
| XLogP | 2.45 |
| TPSA | 176.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|