C28H37N6O2+ — CID 143110669
3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-(5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide (PubChem CID 143110669) has the molecular formula C28H37N6O2+ and a molecular weight of 489.64 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-(5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-(5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 143110669 |
| Molecular Formula | C28H37N6O2+ |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(2-cyclopropyl-3-methyl-1H-imidazol-3-ium-4-yl)ethenyl]amino]-N-(5-tert-butyl-2-methoxyphenyl)-4-methylbenzamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)c1ccc(C)c(N(N)/C=C(\N)c2c[nH]c(C3CC3)[n+]2C)c1 |
| InChI | InChI=1S/C28H36N6O2/c1-17-7-8-19(27(35)32-22-14-20(28(2,3)4)11-12-25(22)36-6)13-23(17)34(30)16-21(29)24-15-31-26(33(24)5)18-9-10-18/h7-8,11-16,18H,9-10,29-30H2,1-6H3,(H,32,35)/p+1/b21-16- |
| InChIKey | HBJLALGESSUQTB-PGMHBOJBSA-O |
| XLogP | 4.22 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|