C34H44N7O4S+ — CID 143110873
CID 143110873 (PubChem CID 143110873) has the molecular formula C34H44N7O4S+ and a molecular weight of 646.84 g/mol.
| Compound Name | CID 143110873 |
|---|---|
| PubChem CID | 143110873 |
| Molecular Formula | C34H44N7O4S+ |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | — |
| SMILES | COc1c(NC(=O)c2ccc(C)c(N(N)/C=C(\N)C3=C(C4CC4)N(c4ccccc4)NC3)c2)cc(C(C)(C)C)cc1N[S+](C)(=O)O |
| InChI | InChI=1S/C34H43N7O4S/c1-21-12-13-23(33(42)38-28-17-24(34(2,3)4)18-29(32(28)45-5)39-46(6,43)44)16-30(21)40(36)20-27(35)26-19-37-41(31(26)22-14-15-22)25-10-8-7-9-11-25/h7-13,16-18,20,22,37H,14-15,19,35-36H2,1-6H3,(H2-,38,39,42,43,44)/p+1/b27-20- |
| InChIKey | ZDJRRYCJAOFXAH-OOAXWGSJSA-O |
| XLogP | 5.65 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|