C23H30ClN5O6S — CID 142903981
methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-chloroanilino]prop-2-enoate (PubChem CID 142903981) has the molecular formula C23H30ClN5O6S and a molecular weight of 540.04 g/mol. Its IUPAC name is methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-chloroanilino]prop-2-enoate.
| Compound Name | methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-chloroanilino]prop-2-enoate |
|---|---|
| PubChem CID | 142903981 |
| Molecular Formula | C23H30ClN5O6S |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | methyl (Z)-2-amino-3-[N-amino-5-[[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]carbamoyl]-2-chloroanilino]prop-2-enoate |
| SMILES | COC(=O)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(C(C)(C)C)cc(NS(C)(=O)=O)c2OC)ccc1Cl |
| InChI | InChI=1S/C23H30ClN5O6S/c1-23(2,3)14-10-17(20(34-4)18(11-14)28-36(6,32)33)27-21(30)13-7-8-15(24)19(9-13)29(26)12-16(25)22(31)35-5/h7-12,28H,25-26H2,1-6H3,(H,27,30)/b16-12- |
| InChIKey | HQEBTSHHKJKWSB-VBKFSLOCSA-N |
| XLogP | 2.92 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|