C29H36F3N7O3 — CID 71034865
3-[amino-[(Z)-2-amino-2-(1,5-dimethylpyrazol-4-yl)ethenyl]amino]-4-methyl-N-[3-(3-morpholin-4-ylpropoxy)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 71034865) has the molecular formula C29H36F3N7O3 and a molecular weight of 587.65 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-(1,5-dimethylpyrazol-4-yl)ethenyl]amino]-4-methyl-N-[3-(3-morpholin-4-ylpropoxy)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[amino-[(Z)-2-amino-2-(1,5-dimethylpyrazol-4-yl)ethenyl]amino]-4-methyl-N-[3-(3-morpholin-4-ylpropoxy)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 71034865 |
| Molecular Formula | C29H36F3N7O3 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-(1,5-dimethylpyrazol-4-yl)ethenyl]amino]-4-methyl-N-[3-(3-morpholin-4-ylpropoxy)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(OCCCN3CCOCC3)cc(C(F)(F)F)c2)cc1N(N)/C=C(\N)c1cnn(C)c1C |
| InChI | InChI=1S/C29H36F3N7O3/c1-19-5-6-21(13-27(19)39(34)18-26(33)25-17-35-37(3)20(25)2)28(40)36-23-14-22(29(30,31)32)15-24(16-23)42-10-4-7-38-8-11-41-12-9-38/h5-6,13-18H,4,7-12,33-34H2,1-3H3,(H,36,40)/b26-18- |
| InChIKey | RUYYOVGFSHCYON-ITYLOYPMSA-N |
| XLogP | 4.05 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|