C29H33F3N8O2 — CID 162600407
3-[[(Z)-2-(2-acetamidopyrimidin-5-yl)-2-(methylamino)ethenyl]-aminoamino]-4-methyl-N-[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 162600407) has the molecular formula C29H33F3N8O2 and a molecular weight of 582.63 g/mol. Its IUPAC name is 3-[[(Z)-2-(2-acetamidopyrimidin-5-yl)-2-(methylamino)ethenyl]-aminoamino]-4-methyl-N-[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[(Z)-2-(2-acetamidopyrimidin-5-yl)-2-(methylamino)ethenyl]-aminoamino]-4-methyl-N-[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 162600407 |
| Molecular Formula | C29H33F3N8O2 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 3-[[(Z)-2-(2-acetamidopyrimidin-5-yl)-2-(methylamino)ethenyl]-aminoamino]-4-methyl-N-[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN/C(=C\N(N)c1cc(C(=O)Nc2cc(CN3CCCC3)cc(C(F)(F)F)c2)ccc1C)c1cnc(NC(C)=O)nc1 |
| InChI | InChI=1S/C29H33F3N8O2/c1-18-6-7-21(12-26(18)40(33)17-25(34-3)22-14-35-28(36-15-22)37-19(2)41)27(42)38-24-11-20(16-39-8-4-5-9-39)10-23(13-24)29(30,31)32/h6-7,10-15,17,34H,4-5,8-9,16,33H2,1-3H3,(H,38,42)(H,35,36,37,41)/b25-17- |
| InChIKey | JLNRTPZWVAQDJU-UQQQWYQISA-N |
| XLogP | 4.51 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|