C28H31F3N6O2 — CID 155207239
3-[(3Z,5E)-3,6-diamino-6-formamidohexa-3,5-dien-1-ynyl]-4-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 155207239) has the molecular formula C28H31F3N6O2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 3-[(3Z,5E)-3,6-diamino-6-formamidohexa-3,5-dien-1-ynyl]-4-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(3Z,5E)-3,6-diamino-6-formamidohexa-3,5-dien-1-ynyl]-4-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155207239 |
| Molecular Formula | C28H31F3N6O2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 3-[(3Z,5E)-3,6-diamino-6-formamidohexa-3,5-dien-1-ynyl]-4-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(CN3CCN(C)CC3)cc(C(F)(F)F)c2)cc1C#C/C(N)=C/C=C(\N)NC=O |
| InChI | InChI=1S/C28H31F3N6O2/c1-19-3-4-22(15-21(19)5-6-24(32)7-8-26(33)34-18-38)27(39)35-25-14-20(13-23(16-25)28(29,30)31)17-37-11-9-36(2)10-12-37/h3-4,7-8,13-16,18H,9-12,17,32-33H2,1-2H3,(H,34,38)(H,35,39)/b24-7-,26-8+ |
| InChIKey | ULYJRVSDRDICCM-TTXDEBRHSA-N |
| XLogP | 2.75 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|