C22H27N3O — CID 58148335
CID 58148335 (PubChem CID 58148335) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol.
| Compound Name | CID 58148335 |
|---|---|
| PubChem CID | 58148335 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | — |
| SMILES | [CH]c1cc(C(=O)Nc2cc(C)cc(CN3CCN(C)CC3)c2)ccc1C |
| InChI | InChI=1S/C22H27N3O/c1-16-11-19(15-25-9-7-24(4)8-10-25)14-21(12-16)23-22(26)20-6-5-17(2)18(3)13-20/h3,5-6,11-14H,7-10,15H2,1-2,4H3,(H,23,26) |
| InChIKey | MQJADIYIBSWHCC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |