C21H24N2O — CID 58148317
CID 58148317 (PubChem CID 58148317) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol.
| Compound Name | CID 58148317 |
|---|---|
| PubChem CID | 58148317 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | — |
| SMILES | [CH]c1cc(C(=O)Nc2cc(C)cc(CN3CCCC3)c2)ccc1C |
| InChI | InChI=1S/C21H24N2O/c1-15-10-18(14-23-8-4-5-9-23)13-20(11-15)22-21(24)19-7-6-16(2)17(3)12-19/h3,6-7,10-13H,4-5,8-9,14H2,1-2H3,(H,22,24) |
| InChIKey | GZSUWZXQMQXSKN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |