C26H28F3N7O — CID 162544598
N-[3-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)benzamide (PubChem CID 162544598) has the molecular formula C26H28F3N7O and a molecular weight of 511.55 g/mol. Its IUPAC name is N-[3-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162544598 |
| Molecular Formula | C26H28F3N7O |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-[3-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(CN3CCCC3)cc(C(F)(F)F)c2)cc1N(N)/C=C(\N)c1cncnc1 |
| InChI | InChI=1S/C26H28F3N7O/c1-17-4-5-22(11-24(17)36(31)15-23(30)20-12-32-16-33-13-20)34-25(37)19-8-18(14-35-6-2-3-7-35)9-21(10-19)26(27,28)29/h4-5,8-13,15-16H,2-3,6-7,14,30-31H2,1H3,(H,34,37)/b23-15- |
| InChIKey | VURAQECCITTWCR-HAHDFKILSA-N |
| XLogP | 4.29 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|