C27H31F3N8O — CID 162600455
N-[3-[amino-[(Z)-2-(methylamino)-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)benzamide (PubChem CID 162600455) has the molecular formula C27H31F3N8O and a molecular weight of 540.59 g/mol. Its IUPAC name is N-[3-[amino-[(Z)-2-(methylamino)-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[amino-[(Z)-2-(methylamino)-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162600455 |
| Molecular Formula | C27H31F3N8O |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[3-[amino-[(Z)-2-(methylamino)-2-pyrimidin-5-ylethenyl]amino]-4-methylphenyl]-3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)benzamide |
| SMILES | CN/C(=C\N(N)c1cc(NC(=O)c2cc(N3CCN(C)CC3)cc(C(F)(F)F)c2)ccc1C)c1cncnc1 |
| InChI | InChI=1S/C27H31F3N8O/c1-18-4-5-22(13-25(18)38(31)16-24(32-2)20-14-33-17-34-15-20)35-26(39)19-10-21(27(28,29)30)12-23(11-19)37-8-6-36(3)7-9-37/h4-5,10-17,32H,6-9,31H2,1-3H3,(H,35,39)/b24-16- |
| InChIKey | RHZGIOKRQIWPRF-JLPGSUDCSA-N |
| XLogP | 3.71 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|