C26H37NO8S — CID 123224608
14,16-dihydroxy-5,9,20-trimethyl-15-(2-sulfooxyethyl)-15-azahexacyclo[10.5.4.01,10.04,9.013,17.018,21]henicosa-13,16-diene-5-carboxylic acid (PubChem CID 123224608) has the molecular formula C26H37NO8S and a molecular weight of 523.65 g/mol. Its IUPAC name is 14,16-dihydroxy-5,9,20-trimethyl-15-(2-sulfooxyethyl)-15-azahexacyclo[10.5.4.01,10.04,9.013,17.018,21]henicosa-13,16-diene-5-carboxylic acid.
| Compound Name | 14,16-dihydroxy-5,9,20-trimethyl-15-(2-sulfooxyethyl)-15-azahexacyclo[10.5.4.01,10.04,9.013,17.018,21]henicosa-13,16-diene-5-carboxylic acid |
|---|---|
| PubChem CID | 123224608 |
| Molecular Formula | C26H37NO8S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 14,16-dihydroxy-5,9,20-trimethyl-15-(2-sulfooxyethyl)-15-azahexacyclo[10.5.4.01,10.04,9.013,17.018,21]henicosa-13,16-diene-5-carboxylic acid |
| SMILES | CC1CC2C1C1CC3C4(C)CCCC(C)(C(=O)O)C4CCC23c2c1c(O)n(CCOS(=O)(=O)O)c2O |
| InChI | InChI=1S/C26H37NO8S/c1-13-11-15-18(13)14-12-17-24(2)6-4-7-25(3,23(30)31)16(24)5-8-26(15,17)20-19(14)21(28)27(22(20)29)9-10-35-36(32,33)34/h13-18,28-29H,4-12H2,1-3H3,(H,30,31)(H,32,33,34) |
| InChIKey | YNOWQNKTANLVJV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|