C29H49NO8S — CID 123355137
6-[1,3-dihydroxy-2-(2-sulfooxyethyl)-7-(2,2,4,4-tetramethylpentyl)-4,7-dihydroisoindol-4-yl]-3,3,5,5-tetramethylhexanoic acid (PubChem CID 123355137) has the molecular formula C29H49NO8S and a molecular weight of 571.78 g/mol. Its IUPAC name is 6-[1,3-dihydroxy-2-(2-sulfooxyethyl)-7-(2,2,4,4-tetramethylpentyl)-4,7-dihydroisoindol-4-yl]-3,3,5,5-tetramethylhexanoic acid.
| Compound Name | 6-[1,3-dihydroxy-2-(2-sulfooxyethyl)-7-(2,2,4,4-tetramethylpentyl)-4,7-dihydroisoindol-4-yl]-3,3,5,5-tetramethylhexanoic acid |
|---|---|
| PubChem CID | 123355137 |
| Molecular Formula | C29H49NO8S |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 6-[1,3-dihydroxy-2-(2-sulfooxyethyl)-7-(2,2,4,4-tetramethylpentyl)-4,7-dihydroisoindol-4-yl]-3,3,5,5-tetramethylhexanoic acid |
| SMILES | CC(C)(C)CC(C)(C)CC1C=CC(CC(C)(C)CC(C)(C)CC(=O)O)c2c1c(O)n(CCOS(=O)(=O)O)c2O |
| InChI | InChI=1S/C29H49NO8S/c1-26(2,3)17-27(4,5)14-19-10-11-20(15-28(6,7)18-29(8,9)16-21(31)32)23-22(19)24(33)30(25(23)34)12-13-38-39(35,36)37/h10-11,19-20,33-34H,12-18H2,1-9H3,(H,31,32)(H,35,36,37) |
| InChIKey | CDJRRCUYRGPEBT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|