C28H34N2O8 — CID 54519142
bis[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 54519142) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is bis[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | bis[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54519142 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | bis[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(OCCn1c(O)c2c(c1O)CC=CC2)C1CCCCC1C(=O)OCCn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C28H34N2O8/c31-23-17-7-1-2-8-18(17)24(32)29(23)13-15-37-27(35)21-11-5-6-12-22(21)28(36)38-16-14-30-25(33)19-9-3-4-10-20(19)26(30)34/h1-4,21-22,31-34H,5-16H2 |
| InChIKey | YONNDWJCLGQZJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|