C28H34N2O10 — CID 54156838
bis[2-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 54156838) has the molecular formula C28H34N2O10 and a molecular weight of 558.58 g/mol. Its IUPAC name is bis[2-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)ethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | bis[2-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)ethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54156838 |
| Molecular Formula | C28H34N2O10 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | bis[2-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(OCCn1c(O)c2c(c1O)CC1OC1C2)C1CCCCC1C(=O)OCCn1c(O)c2c(c1O)CC1OC1C2 |
| InChI | InChI=1S/C28H34N2O10/c31-23-15-9-19-20(39-19)10-16(15)24(32)29(23)5-7-37-27(35)13-3-1-2-4-14(13)28(36)38-8-6-30-25(33)17-11-21-22(40-21)12-18(17)26(30)34/h13-14,19-22,31-34H,1-12H2 |
| InChIKey | OLRGFFMNQJPJFX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|