C33H47N3O15 — CID 163685839
2-[2-[3,5-bis[2-(2-carboxycyclohexanecarbonyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy-hydroxymethyl]cyclohexane-1-carboxylic acid (PubChem CID 163685839) has the molecular formula C33H47N3O15 and a molecular weight of 725.74 g/mol. Its IUPAC name is 2-[2-[3,5-bis[2-(2-carboxycyclohexanecarbonyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy-hydroxymethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-[3,5-bis[2-(2-carboxycyclohexanecarbonyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy-hydroxymethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163685839 |
| Molecular Formula | C33H47N3O15 |
| Molecular Weight | 725.74 g/mol |
| Exact Mass | 725.30 |
| IUPAC Name | 2-[2-[3,5-bis[2-(2-carboxycyclohexanecarbonyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy-hydroxymethyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OCCn1c(=O)n(CCOC(=O)C2CCCCC2C(=O)O)c(=O)n(CCOC(O)C2CCCCC2C(=O)O)c1=O |
| InChI | InChI=1S/C33H47N3O15/c37-25(38)19-7-1-4-10-22(19)28(43)49-16-13-34-31(46)35(14-17-50-29(44)23-11-5-2-8-20(23)26(39)40)33(48)36(32(34)47)15-18-51-30(45)24-12-6-3-9-21(24)27(41)42/h19-24,28,43H,1-18H2,(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | JOUPSINEOORMRK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 259.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.74 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|