C30H39N3O9 — CID 163876546
2-[3,5-bis[2-(cyclohex-3-ene-1-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl cyclohex-3-ene-1-carboxylate (PubChem CID 163876546) has the molecular formula C30H39N3O9 and a molecular weight of 585.65 g/mol. Its IUPAC name is 2-[3,5-bis[2-(cyclohex-3-ene-1-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl cyclohex-3-ene-1-carboxylate.
| Compound Name | 2-[3,5-bis[2-(cyclohex-3-ene-1-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 163876546 |
| Molecular Formula | C30H39N3O9 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 2-[3,5-bis[2-(cyclohex-3-ene-1-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCCn1c(=O)n(CCOC(=O)C2CC=CCC2)c(=O)n(CCOC(=O)C2CC=CCC2)c1=O)C1CC=CCC1 |
| InChI | InChI=1S/C30H39N3O9/c34-25(22-10-4-1-5-11-22)40-19-16-31-28(37)32(17-20-41-26(35)23-12-6-2-7-13-23)30(39)33(29(31)38)18-21-42-27(36)24-14-8-3-9-15-24/h1-4,6,8,22-24H,5,7,9-21H2 |
| InChIKey | PPJUDGUWJRDZMZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|