C26H32N2O8 — CID 91537605
2-[5-[1,3-dihydroxy-2-(2-prop-2-enoyloxyethyl)-4,5,6,7-tetrahydroisoindol-5-yl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl]ethyl prop-2-enoate (PubChem CID 91537605) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[5-[1,3-dihydroxy-2-(2-prop-2-enoyloxyethyl)-4,5,6,7-tetrahydroisoindol-5-yl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl]ethyl prop-2-enoate.
| Compound Name | 2-[5-[1,3-dihydroxy-2-(2-prop-2-enoyloxyethyl)-4,5,6,7-tetrahydroisoindol-5-yl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91537605 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[5-[1,3-dihydroxy-2-(2-prop-2-enoyloxyethyl)-4,5,6,7-tetrahydroisoindol-5-yl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1c(O)c2c(c1O)CC(C1CCc3c(c(O)n(CCOC(=O)C=C)c3O)C1)CC2 |
| InChI | InChI=1S/C26H32N2O8/c1-3-21(29)35-11-9-27-23(31)17-7-5-15(13-19(17)25(27)33)16-6-8-18-20(14-16)26(34)28(24(18)32)10-12-36-22(30)4-2/h3-4,15-16,31-34H,1-2,5-14H2 |
| InChIKey | BCRPGQVHONOMGQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|