C14H19NO4 — CID 54534582
3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)propyl prop-2-enoate (PubChem CID 54534582) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)propyl prop-2-enoate.
| Compound Name | 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 54534582 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C14H19NO4/c1-2-12(16)19-9-5-8-15-13(17)10-6-3-4-7-11(10)14(15)18/h2,17-18H,1,3-9H2 |
| InChIKey | YYWUYBBKRHXOLQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|