C18H19NO4 — CID 54113372
2-(1,3-dihydroxy-4,5-dihydrobenzo[e]isoindol-2-yl)ethyl 2-methylprop-2-enoate (PubChem CID 54113372) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(1,3-dihydroxy-4,5-dihydrobenzo[e]isoindol-2-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,3-dihydroxy-4,5-dihydrobenzo[e]isoindol-2-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54113372 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(1,3-dihydroxy-4,5-dihydrobenzo[e]isoindol-2-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c(O)c2c(c1O)-c1ccccc1CC2 |
| InChI | InChI=1S/C18H19NO4/c1-11(2)18(22)23-10-9-19-16(20)14-8-7-12-5-3-4-6-13(12)15(14)17(19)21/h3-6,20-21H,1,7-10H2,2H3 |
| InChIKey | NIQMRNKZHGCQFG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|