C18H21NO2 — CID 91054382
11-butyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10,12-diol (PubChem CID 91054382) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 11-butyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10,12-diol.
| Compound Name | 11-butyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10,12-diol |
|---|---|
| PubChem CID | 91054382 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 11-butyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10,12-diol |
| SMILES | CCCCn1c(O)c2c(c1O)C1CCC2c2ccccc21 |
| InChI | InChI=1S/C18H21NO2/c1-2-3-10-19-17(20)15-13-8-9-14(16(15)18(19)21)12-7-5-4-6-11(12)13/h4-7,13-14,20-21H,2-3,8-10H2,1H3 |
| InChIKey | WRLWROUUOICHOE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |