C24H12F5NO2 — CID 123242163
17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13,15,18-octaene-16,18-diol (PubChem CID 123242163) has the molecular formula C24H12F5NO2 and a molecular weight of 441.36 g/mol. Its IUPAC name is 17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13,15,18-octaene-16,18-diol.
| Compound Name | 17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13,15,18-octaene-16,18-diol |
|---|---|
| PubChem CID | 123242163 |
| Molecular Formula | C24H12F5NO2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13,15,18-octaene-16,18-diol |
| SMILES | Oc1c2c(c(O)n1-c1c(F)c(F)c(F)c(F)c1F)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C24H12F5NO2/c25-17-18(26)20(28)22(21(29)19(17)27)30-23(31)15-13-9-5-1-2-6-10(9)14(16(15)24(30)32)12-8-4-3-7-11(12)13/h1-8,13-14,31-32H |
| InChIKey | WMVFWMUWWLYKEG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|