C14H14FNO2 — CID 123536853
2-(4-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 123536853) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-(4-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 123536853 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(4-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccc(F)cc1)CCCC2 |
| InChI | InChI=1S/C14H14FNO2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h5-8,17-18H,1-4H2 |
| InChIKey | ONLCUPTWEFNYKN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |