C11H11NO2 — CID 90898575
1-(4-methylphenyl)pyrrole-2,5-diol (PubChem CID 90898575) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(4-methylphenyl)pyrrole-2,5-diol.
| Compound Name | 1-(4-methylphenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90898575 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-(4-methylphenyl)pyrrole-2,5-diol |
| SMILES | Cc1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C11H11NO2/c1-8-2-4-9(5-3-8)12-10(13)6-7-11(12)14/h2-7,13-14H,1H3 |
| InChIKey | OGFWICKBXXUZBA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |