C18H16F3NO2 — CID 90715851
(1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 90715851) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90715851 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (1S,7R,8R,10S)-4-[3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cccc(C(F)(F)F)c1)[C@@H]1CC[C@H]2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)8-2-1-3-9(6-8)22-16(23)14-10-4-5-11(13-7-12(10)13)15(14)17(22)24/h1-3,6,10-13,23-24H,4-5,7H2/t10-,11+,12+,13- |
| InChIKey | QDOVYDOTSAVHBE-FNFFVJSTSA-N |
| XLogP | 4.52 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |