C25H35FN2O3 — CID 54030180
2-[4-[4-[(4-fluorophenyl)-methoxymethyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54030180) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-[4-[4-[(4-fluorophenyl)-methoxymethyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-[4-[(4-fluorophenyl)-methoxymethyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54030180 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-[4-[4-[(4-fluorophenyl)-methoxymethyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | COC(c1ccc(F)cc1)C1CCN(CCCCn2c(O)c3c(c2O)CCCC3)CC1 |
| InChI | InChI=1S/C25H35FN2O3/c1-31-23(18-8-10-20(26)11-9-18)19-12-16-27(17-13-19)14-4-5-15-28-24(29)21-6-2-3-7-22(21)25(28)30/h8-11,19,23,29-30H,2-7,12-17H2,1H3 |
| InChIKey | LFALXGSKJOQGFN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|