C24H22N2O8 — CID 91126267
2-[1,3-dihydroxy-6,8-dioxo-7-(2-prop-2-enoyloxyethyl)-4,10-dihydroisoindolo[5,6-f]isoindol-2-yl]ethyl prop-2-enoate (PubChem CID 91126267) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-[1,3-dihydroxy-6,8-dioxo-7-(2-prop-2-enoyloxyethyl)-4,10-dihydroisoindolo[5,6-f]isoindol-2-yl]ethyl prop-2-enoate.
| Compound Name | 2-[1,3-dihydroxy-6,8-dioxo-7-(2-prop-2-enoyloxyethyl)-4,10-dihydroisoindolo[5,6-f]isoindol-2-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91126267 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[1,3-dihydroxy-6,8-dioxo-7-(2-prop-2-enoyloxyethyl)-4,10-dihydroisoindolo[5,6-f]isoindol-2-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1C(=O)c2cc3c(cc2C1=O)Cc1c(c(O)n(CCOC(=O)C=C)c1O)C3 |
| InChI | InChI=1S/C24H22N2O8/c1-3-19(27)33-7-5-25-21(29)15-9-13-11-17-18(12-14(13)10-16(15)22(25)30)24(32)26(23(17)31)6-8-34-20(28)4-2/h3-4,9-10,31-32H,1-2,5-8,11-12H2 |
| InChIKey | JTYDUPXEVUISCJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|